C14H20ClNO4 — CID 60879110
ethyl 2-[2-chloro-4-(ethylaminomethyl)-6-methoxyphenoxy]acetate (PubChem CID 60879110) has the molecular formula C14H20ClNO4 and a molecular weight of 301.77 g/mol. Its IUPAC name is ethyl 2-[2-chloro-4-(ethylaminomethyl)-6-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[2-chloro-4-(ethylaminomethyl)-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 60879110 |
| Molecular Formula | C14H20ClNO4 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | ethyl 2-[2-chloro-4-(ethylaminomethyl)-6-methoxyphenoxy]acetate |
| SMILES | CCNCc1cc(Cl)c(OCC(=O)OCC)c(OC)c1 |
| InChI | InChI=1S/C14H20ClNO4/c1-4-16-8-10-6-11(15)14(12(7-10)18-3)20-9-13(17)19-5-2/h6-7,16H,4-5,8-9H2,1-3H3 |
| InChIKey | KLJQVWBTXVFDNY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |