C13H18ClN3O4 — CID 43214903
2-[[4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]methylamino]-N-methylacetamide (PubChem CID 43214903) has the molecular formula C13H18ClN3O4 and a molecular weight of 315.76 g/mol. Its IUPAC name is 2-[[4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]methylamino]-N-methylacetamide.
| Compound Name | 2-[[4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]methylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 43214903 |
| Molecular Formula | C13H18ClN3O4 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 2-[[4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]methylamino]-N-methylacetamide |
| SMILES | CNC(=O)CNCc1cc(Cl)c(OCC(N)=O)c(OC)c1 |
| InChI | InChI=1S/C13H18ClN3O4/c1-16-12(19)6-17-5-8-3-9(14)13(10(4-8)20-2)21-7-11(15)18/h3-4,17H,5-7H2,1-2H3,(H2,15,18)(H,16,19) |
| InChIKey | SNZQJZJSJOBOSG-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |