C14H17ClN2O3 — CID 115866328
2-[4-[(but-2-ynylamino)methyl]-2-chloro-6-methoxyphenoxy]acetamide (PubChem CID 115866328) has the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. Its IUPAC name is 2-[4-[(but-2-ynylamino)methyl]-2-chloro-6-methoxyphenoxy]acetamide.
| Compound Name | 2-[4-[(but-2-ynylamino)methyl]-2-chloro-6-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 115866328 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 2-[4-[(but-2-ynylamino)methyl]-2-chloro-6-methoxyphenoxy]acetamide |
| SMILES | CC#CCNCc1cc(Cl)c(OCC(N)=O)c(OC)c1 |
| InChI | InChI=1S/C14H17ClN2O3/c1-3-4-5-17-8-10-6-11(15)14(12(7-10)19-2)20-9-13(16)18/h6-7,17H,5,8-9H2,1-2H3,(H2,16,18) |
| InChIKey | DAPHRSXBWCPHAQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|