C15H26Cl3N3O3 — CID 17293104
2-[2-chloro-4-[[3-(dimethylamino)propylamino]methyl]-6-methoxyphenoxy]acetamide;dihydrochloride (PubChem CID 17293104) has the molecular formula C15H26Cl3N3O3 and a molecular weight of 402.75 g/mol. Its IUPAC name is 2-[2-chloro-4-[[3-(dimethylamino)propylamino]methyl]-6-methoxyphenoxy]acetamide;dihydrochloride.
| Compound Name | 2-[2-chloro-4-[[3-(dimethylamino)propylamino]methyl]-6-methoxyphenoxy]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 17293104 |
| Molecular Formula | C15H26Cl3N3O3 |
| Molecular Weight | 402.75 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 2-[2-chloro-4-[[3-(dimethylamino)propylamino]methyl]-6-methoxyphenoxy]acetamide;dihydrochloride |
| SMILES | COc1cc(CNCCCN(C)C)cc(Cl)c1OCC(N)=O.Cl.Cl |
| InChI | InChI=1S/C15H24ClN3O3.2ClH/c1-19(2)6-4-5-18-9-11-7-12(16)15(13(8-11)21-3)22-10-14(17)20;;/h7-8,18H,4-6,9-10H2,1-3H3,(H2,17,20);2*1H |
| InChIKey | QCRNDVPZHNSYFC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.75 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|