C15H24ClN3O3 — CID 4720831
2-[2-chloro-6-ethoxy-4-[[3-(methylamino)propylamino]methyl]phenoxy]acetamide (PubChem CID 4720831) has the molecular formula C15H24ClN3O3 and a molecular weight of 329.83 g/mol. Its IUPAC name is 2-[2-chloro-6-ethoxy-4-[[3-(methylamino)propylamino]methyl]phenoxy]acetamide.
| Compound Name | 2-[2-chloro-6-ethoxy-4-[[3-(methylamino)propylamino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 4720831 |
| Molecular Formula | C15H24ClN3O3 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 2-[2-chloro-6-ethoxy-4-[[3-(methylamino)propylamino]methyl]phenoxy]acetamide |
| SMILES | CCOc1cc(CNCCCNC)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C15H24ClN3O3/c1-3-21-13-8-11(9-19-6-4-5-18-2)7-12(16)15(13)22-10-14(17)20/h7-8,18-19H,3-6,9-10H2,1-2H3,(H2,17,20) |
| InChIKey | RYYQWCVUSOPMPI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|