C19H24ClN3O5S — CID 4718653
2-[2-chloro-6-ethoxy-4-[[2-(4-sulfamoylphenyl)ethylamino]methyl]phenoxy]acetamide (PubChem CID 4718653) has the molecular formula C19H24ClN3O5S and a molecular weight of 441.94 g/mol. Its IUPAC name is 2-[2-chloro-6-ethoxy-4-[[2-(4-sulfamoylphenyl)ethylamino]methyl]phenoxy]acetamide.
| Compound Name | 2-[2-chloro-6-ethoxy-4-[[2-(4-sulfamoylphenyl)ethylamino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 4718653 |
| Molecular Formula | C19H24ClN3O5S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 2-[2-chloro-6-ethoxy-4-[[2-(4-sulfamoylphenyl)ethylamino]methyl]phenoxy]acetamide |
| SMILES | CCOc1cc(CNCCc2ccc(S(N)(=O)=O)cc2)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C19H24ClN3O5S/c1-2-27-17-10-14(9-16(20)19(17)28-12-18(21)24)11-23-8-7-13-3-5-15(6-4-13)29(22,25)26/h3-6,9-10,23H,2,7-8,11-12H2,1H3,(H2,21,24)(H2,22,25,26) |
| InChIKey | HARCFTPQMSJVEH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|