C17H22BrClN2O3S — CID 17158026
4-[2-[(3-bromo-4-ethoxyphenyl)methylamino]ethyl]benzenesulfonamide;hydrochloride (PubChem CID 17158026) has the molecular formula C17H22BrClN2O3S and a molecular weight of 449.80 g/mol. Its IUPAC name is 4-[2-[(3-bromo-4-ethoxyphenyl)methylamino]ethyl]benzenesulfonamide;hydrochloride.
| Compound Name | 4-[2-[(3-bromo-4-ethoxyphenyl)methylamino]ethyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 17158026 |
| Molecular Formula | C17H22BrClN2O3S |
| Molecular Weight | 449.80 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | 4-[2-[(3-bromo-4-ethoxyphenyl)methylamino]ethyl]benzenesulfonamide;hydrochloride |
| SMILES | CCOc1ccc(CNCCc2ccc(S(N)(=O)=O)cc2)cc1Br.Cl |
| InChI | InChI=1S/C17H21BrN2O3S.ClH/c1-2-23-17-8-5-14(11-16(17)18)12-20-10-9-13-3-6-15(7-4-13)24(19,21)22;/h3-8,11,20H,2,9-10,12H2,1H3,(H2,19,21,22);1H |
| InChIKey | XFPWDPIGDNJCIF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.80 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|