C17H20BrN3O4S — CID 17053803
2-[4-bromo-2-[[2-(4-sulfamoylphenyl)ethylamino]methyl]phenoxy]acetamide (PubChem CID 17053803) has the molecular formula C17H20BrN3O4S and a molecular weight of 442.34 g/mol. Its IUPAC name is 2-[4-bromo-2-[[2-(4-sulfamoylphenyl)ethylamino]methyl]phenoxy]acetamide.
| Compound Name | 2-[4-bromo-2-[[2-(4-sulfamoylphenyl)ethylamino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 17053803 |
| Molecular Formula | C17H20BrN3O4S |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 2-[4-bromo-2-[[2-(4-sulfamoylphenyl)ethylamino]methyl]phenoxy]acetamide |
| SMILES | NC(=O)COc1ccc(Br)cc1CNCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H20BrN3O4S/c18-14-3-6-16(25-11-17(19)22)13(9-14)10-21-8-7-12-1-4-15(5-2-12)26(20,23)24/h1-6,9,21H,7-8,10-11H2,(H2,19,22)(H2,20,23,24) |
| InChIKey | HUURNJDPJKOXIO-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|