C22H23BrClN2O3S- — CID 53347420
4-[2-[(5-bromo-2-phenylmethoxyphenyl)methylamino]ethyl]benzenesulfonamide chloride (PubChem CID 53347420) has the molecular formula C22H23BrClN2O3S- and a molecular weight of 510.86 g/mol. Its IUPAC name is 4-[2-[(5-bromo-2-phenylmethoxyphenyl)methylamino]ethyl]benzenesulfonamide chloride.
| Compound Name | 4-[2-[(5-bromo-2-phenylmethoxyphenyl)methylamino]ethyl]benzenesulfonamide chloride |
|---|---|
| PubChem CID | 53347420 |
| Molecular Formula | C22H23BrClN2O3S- |
| Molecular Weight | 510.86 g/mol |
| Exact Mass | 509.03 |
| IUPAC Name | 4-[2-[(5-bromo-2-phenylmethoxyphenyl)methylamino]ethyl]benzenesulfonamide chloride |
| SMILES | NS(=O)(=O)c1ccc(CCNCc2cc(Br)ccc2OCc2ccccc2)cc1.[Cl-] |
| InChI | InChI=1S/C22H23BrN2O3S.ClH/c23-20-8-11-22(28-16-18-4-2-1-3-5-18)19(14-20)15-25-13-12-17-6-9-21(10-7-17)29(24,26)27;/h1-11,14,25H,12-13,15-16H2,(H2,24,26,27);1H/p-1 |
| InChIKey | JEAOCMOUPOMLIK-UHFFFAOYSA-M |
| XLogP | 1.01 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.86 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|