C17H21BrN2O4S — CID 29227830
4-[2-[(5-bromo-2,3-dimethoxyphenyl)methylamino]ethyl]benzenesulfonamide (PubChem CID 29227830) has the molecular formula C17H21BrN2O4S and a molecular weight of 429.34 g/mol. Its IUPAC name is 4-[2-[(5-bromo-2,3-dimethoxyphenyl)methylamino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[(5-bromo-2,3-dimethoxyphenyl)methylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 29227830 |
| Molecular Formula | C17H21BrN2O4S |
| Molecular Weight | 429.34 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | 4-[2-[(5-bromo-2,3-dimethoxyphenyl)methylamino]ethyl]benzenesulfonamide |
| SMILES | COc1cc(Br)cc(CNCCc2ccc(S(N)(=O)=O)cc2)c1OC |
| InChI | InChI=1S/C17H21BrN2O4S/c1-23-16-10-14(18)9-13(17(16)24-2)11-20-8-7-12-3-5-15(6-4-12)25(19,21)22/h3-6,9-10,20H,7-8,11H2,1-2H3,(H2,19,21,22) |
| InChIKey | FVJCQHCHFMWDRS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|