C18H21N3O3S — CID 42646833
4-[2-[(5-methoxy-1H-indol-3-yl)methylamino]ethyl]benzenesulfonamide (PubChem CID 42646833) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is 4-[2-[(5-methoxy-1H-indol-3-yl)methylamino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[(5-methoxy-1H-indol-3-yl)methylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 42646833 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 4-[2-[(5-methoxy-1H-indol-3-yl)methylamino]ethyl]benzenesulfonamide |
| SMILES | COc1ccc2[nH]cc(CNCCc3ccc(S(N)(=O)=O)cc3)c2c1 |
| InChI | InChI=1S/C18H21N3O3S/c1-24-15-4-7-18-17(10-15)14(12-21-18)11-20-9-8-13-2-5-16(6-3-13)25(19,22)23/h2-7,10,12,20-21H,8-9,11H2,1H3,(H2,19,22,23) |
| InChIKey | FCIVNRKXDVDGRD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|