C17H16Cl2N2O3S — CID 6733520
3,4-dichloro-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]benzenesulfonamide (PubChem CID 6733520) has the molecular formula C17H16Cl2N2O3S and a molecular weight of 399.30 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6733520 |
| Molecular Formula | C17H16Cl2N2O3S |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 3,4-dichloro-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc2[nH]cc(CCNS(=O)(=O)c3ccc(Cl)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C17H16Cl2N2O3S/c1-24-12-2-5-17-14(8-12)11(10-20-17)6-7-21-25(22,23)13-3-4-15(18)16(19)9-13/h2-5,8-10,20-21H,6-7H2,1H3 |
| InChIKey | ITGQSMROFIOXCO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |