C21H19ClN4O3S — CID 53006760
6-(4-chlorophenyl)sulfonyl-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]pyridazin-3-amine (PubChem CID 53006760) has the molecular formula C21H19ClN4O3S and a molecular weight of 442.93 g/mol. Its IUPAC name is 6-(4-chlorophenyl)sulfonyl-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]pyridazin-3-amine.
| Compound Name | 6-(4-chlorophenyl)sulfonyl-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 53006760 |
| Molecular Formula | C21H19ClN4O3S |
| Molecular Weight | 442.93 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 6-(4-chlorophenyl)sulfonyl-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]pyridazin-3-amine |
| SMILES | COc1ccc2[nH]cc(CCNc3ccc(S(=O)(=O)c4ccc(Cl)cc4)nn3)c2c1 |
| InChI | InChI=1S/C21H19ClN4O3S/c1-29-16-4-7-19-18(12-16)14(13-24-19)10-11-23-20-8-9-21(26-25-20)30(27,28)17-5-2-15(22)3-6-17/h2-9,12-13,24H,10-11H2,1H3,(H,23,25) |
| InChIKey | MKFYUESXBQVBGQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.93 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |