C20H18N4O2S — CID 27375773
6-(benzenesulfonyl)-N-[2-(1H-indol-3-yl)ethyl]pyridazin-3-amine (PubChem CID 27375773) has the molecular formula C20H18N4O2S and a molecular weight of 378.46 g/mol. Its IUPAC name is 6-(benzenesulfonyl)-N-[2-(1H-indol-3-yl)ethyl]pyridazin-3-amine.
| Compound Name | 6-(benzenesulfonyl)-N-[2-(1H-indol-3-yl)ethyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 27375773 |
| Molecular Formula | C20H18N4O2S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 6-(benzenesulfonyl)-N-[2-(1H-indol-3-yl)ethyl]pyridazin-3-amine |
| SMILES | O=S(=O)(c1ccccc1)c1ccc(NCCc2c[nH]c3ccccc23)nn1 |
| InChI | InChI=1S/C20H18N4O2S/c25-27(26,16-6-2-1-3-7-16)20-11-10-19(23-24-20)21-13-12-15-14-22-18-9-5-4-8-17(15)18/h1-11,14,22H,12-13H2,(H,21,23) |
| InChIKey | CXSVXXMNWDARBX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |