C24H24N6 — CID 112862352
4-N,6-N-bis[2-(1H-indol-3-yl)ethyl]pyrimidine-4,6-diamine (PubChem CID 112862352) has the molecular formula C24H24N6 and a molecular weight of 396.50 g/mol. Its IUPAC name is 4-N,6-N-bis[2-(1H-indol-3-yl)ethyl]pyrimidine-4,6-diamine.
| Compound Name | 4-N,6-N-bis[2-(1H-indol-3-yl)ethyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112862352 |
| Molecular Formula | C24H24N6 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 4-N,6-N-bis[2-(1H-indol-3-yl)ethyl]pyrimidine-4,6-diamine |
| SMILES | c1ccc2c(CCNc3cc(NCCc4c[nH]c5ccccc45)ncn3)c[nH]c2c1 |
| InChI | InChI=1S/C24H24N6/c1-3-7-21-19(5-1)17(14-27-21)9-11-25-23-13-24(30-16-29-23)26-12-10-18-15-28-22-8-4-2-6-20(18)22/h1-8,13-16,27-28H,9-12H2,(H2,25,26,29,30) |
| InChIKey | AZQOHTHKOGWOLI-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |