C21H25N5O — CID 109342013
N-cyclohexyl-6-[2-(1H-indol-3-yl)ethylamino]pyrimidine-4-carboxamide (PubChem CID 109342013) has the molecular formula C21H25N5O and a molecular weight of 363.46 g/mol. Its IUPAC name is N-cyclohexyl-6-[2-(1H-indol-3-yl)ethylamino]pyrimidine-4-carboxamide.
| Compound Name | N-cyclohexyl-6-[2-(1H-indol-3-yl)ethylamino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109342013 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | N-cyclohexyl-6-[2-(1H-indol-3-yl)ethylamino]pyrimidine-4-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cc(NCCc2c[nH]c3ccccc23)ncn1 |
| InChI | InChI=1S/C21H25N5O/c27-21(26-16-6-2-1-3-7-16)19-12-20(25-14-24-19)22-11-10-15-13-23-18-9-5-4-8-17(15)18/h4-5,8-9,12-14,16,23H,1-3,6-7,10-11H2,(H,26,27)(H,22,24,25) |
| InChIKey | HMYVKWGUZWEPPW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |