C17H19N5 — CID 112854725
4-N-cyclopropyl-6-N-[2-(1H-indol-3-yl)ethyl]pyrimidine-4,6-diamine (PubChem CID 112854725) has the molecular formula C17H19N5 and a molecular weight of 293.37 g/mol. Its IUPAC name is 4-N-cyclopropyl-6-N-[2-(1H-indol-3-yl)ethyl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-cyclopropyl-6-N-[2-(1H-indol-3-yl)ethyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112854725 |
| Molecular Formula | C17H19N5 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 4-N-cyclopropyl-6-N-[2-(1H-indol-3-yl)ethyl]pyrimidine-4,6-diamine |
| SMILES | c1ccc2c(CCNc3cc(NC4CC4)ncn3)c[nH]c2c1 |
| InChI | InChI=1S/C17H19N5/c1-2-4-15-14(3-1)12(10-19-15)7-8-18-16-9-17(21-11-20-16)22-13-5-6-13/h1-4,9-11,13,19H,5-8H2,(H2,18,20,21,22) |
| InChIKey | DAICFYSCSUEMFD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |