C19H22N6O — CID 112858233
4-[6-[2-(1H-indol-3-yl)ethylamino]pyrimidin-4-yl]piperazine-1-carbaldehyde (PubChem CID 112858233) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is 4-[6-[2-(1H-indol-3-yl)ethylamino]pyrimidin-4-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[6-[2-(1H-indol-3-yl)ethylamino]pyrimidin-4-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 112858233 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 4-[6-[2-(1H-indol-3-yl)ethylamino]pyrimidin-4-yl]piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(c2cc(NCCc3c[nH]c4ccccc34)ncn2)CC1 |
| InChI | InChI=1S/C19H22N6O/c26-14-24-7-9-25(10-8-24)19-11-18(22-13-23-19)20-6-5-15-12-21-17-4-2-1-3-16(15)17/h1-4,11-14,21H,5-10H2,(H,20,22,23) |
| InChIKey | HKEKDADSXUMZJY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|