C19H25N5 — CID 112862363
4-N-[2-(1H-indol-3-yl)ethyl]-6-N-pentylpyrimidine-4,6-diamine (PubChem CID 112862363) has the molecular formula C19H25N5 and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-N-[2-(1H-indol-3-yl)ethyl]-6-N-pentylpyrimidine-4,6-diamine.
| Compound Name | 4-N-[2-(1H-indol-3-yl)ethyl]-6-N-pentylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112862363 |
| Molecular Formula | C19H25N5 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 4-N-[2-(1H-indol-3-yl)ethyl]-6-N-pentylpyrimidine-4,6-diamine |
| SMILES | CCCCCNc1cc(NCCc2c[nH]c3ccccc23)ncn1 |
| InChI | InChI=1S/C19H25N5/c1-2-3-6-10-20-18-12-19(24-14-23-18)21-11-9-15-13-22-17-8-5-4-7-16(15)17/h4-5,7-8,12-14,22H,2-3,6,9-11H2,1H3,(H2,20,21,23,24) |
| InChIKey | HAYNYBRTMJNOHC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|