C18H23N5 — CID 112883035
2-N-butyl-4-N-[2-(1H-indol-3-yl)ethyl]pyrimidine-2,4-diamine (PubChem CID 112883035) has the molecular formula C18H23N5 and a molecular weight of 309.42 g/mol. Its IUPAC name is 2-N-butyl-4-N-[2-(1H-indol-3-yl)ethyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-butyl-4-N-[2-(1H-indol-3-yl)ethyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112883035 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 2-N-butyl-4-N-[2-(1H-indol-3-yl)ethyl]pyrimidine-2,4-diamine |
| SMILES | CCCCNc1nccc(NCCc2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C18H23N5/c1-2-3-10-20-18-21-12-9-17(23-18)19-11-8-14-13-22-16-7-5-4-6-15(14)16/h4-7,9,12-13,22H,2-3,8,10-11H2,1H3,(H2,19,20,21,23) |
| InChIKey | DFVUUQVQLACMAF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|