C18H23N5O — CID 112886032
2-N-[2-(1H-indol-3-yl)ethyl]-4-N-(3-methoxypropyl)pyrimidine-2,4-diamine (PubChem CID 112886032) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is 2-N-[2-(1H-indol-3-yl)ethyl]-4-N-(3-methoxypropyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[2-(1H-indol-3-yl)ethyl]-4-N-(3-methoxypropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112886032 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 2-N-[2-(1H-indol-3-yl)ethyl]-4-N-(3-methoxypropyl)pyrimidine-2,4-diamine |
| SMILES | COCCCNc1ccnc(NCCc2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C18H23N5O/c1-24-12-4-9-19-17-8-11-21-18(23-17)20-10-7-14-13-22-16-6-3-2-5-15(14)16/h2-3,5-6,8,11,13,22H,4,7,9-10,12H2,1H3,(H2,19,20,21,23) |
| InChIKey | QWYIXUMOHFAGMM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|