C22H23N5 — CID 112896705
2-N-(2-ethylphenyl)-4-N-[2-(1H-indol-3-yl)ethyl]pyrimidine-2,4-diamine (PubChem CID 112896705) has the molecular formula C22H23N5 and a molecular weight of 357.46 g/mol. Its IUPAC name is 2-N-(2-ethylphenyl)-4-N-[2-(1H-indol-3-yl)ethyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(2-ethylphenyl)-4-N-[2-(1H-indol-3-yl)ethyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112896705 |
| Molecular Formula | C22H23N5 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 2-N-(2-ethylphenyl)-4-N-[2-(1H-indol-3-yl)ethyl]pyrimidine-2,4-diamine |
| SMILES | CCc1ccccc1Nc1nccc(NCCc2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C22H23N5/c1-2-16-7-3-5-9-19(16)26-22-24-14-12-21(27-22)23-13-11-17-15-25-20-10-6-4-8-18(17)20/h3-10,12,14-15,25H,2,11,13H2,1H3,(H2,23,24,26,27) |
| InChIKey | FJOGTHBPXHMBQD-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |