C20H18FN5 — CID 112896748
2-N-(3-fluorophenyl)-4-N-[2-(1H-indol-3-yl)ethyl]pyrimidine-2,4-diamine (PubChem CID 112896748) has the molecular formula C20H18FN5 and a molecular weight of 347.40 g/mol. Its IUPAC name is 2-N-(3-fluorophenyl)-4-N-[2-(1H-indol-3-yl)ethyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(3-fluorophenyl)-4-N-[2-(1H-indol-3-yl)ethyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112896748 |
| Molecular Formula | C20H18FN5 |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-N-(3-fluorophenyl)-4-N-[2-(1H-indol-3-yl)ethyl]pyrimidine-2,4-diamine |
| SMILES | Fc1cccc(Nc2nccc(NCCc3c[nH]c4ccccc34)n2)c1 |
| InChI | InChI=1S/C20H18FN5/c21-15-4-3-5-16(12-15)25-20-23-11-9-19(26-20)22-10-8-14-13-24-18-7-2-1-6-17(14)18/h1-7,9,11-13,24H,8,10H2,(H2,22,23,25,26) |
| InChIKey | HGVKOOOBTVREQA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |