C20H26N6 — CID 112870723
N-[2-(1H-indol-3-yl)ethyl]-2-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 112870723) has the molecular formula C20H26N6 and a molecular weight of 350.47 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-2-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-2-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112870723 |
| Molecular Formula | C20H26N6 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-2-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | Cc1nc(NCCc2c[nH]c3ccccc23)cc(N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C20H26N6/c1-15-23-19(13-20(24-15)26-11-9-25(2)10-12-26)21-8-7-16-14-22-18-6-4-3-5-17(16)18/h3-6,13-14,22H,7-12H2,1-2H3,(H,21,23,24) |
| InChIKey | YFCFLPQIJNJUHL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |