C24H34N8 — CID 46855458
N-[2-(1H-indol-3-yl)ethyl]-4,6-bis(4-methylpiperazin-1-yl)pyrimidin-2-amine (PubChem CID 46855458) has the molecular formula C24H34N8 and a molecular weight of 434.59 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-4,6-bis(4-methylpiperazin-1-yl)pyrimidin-2-amine.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-4,6-bis(4-methylpiperazin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 46855458 |
| Molecular Formula | C24H34N8 |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-4,6-bis(4-methylpiperazin-1-yl)pyrimidin-2-amine |
| SMILES | CN1CCN(c2cc(N3CCN(C)CC3)nc(NCCc3c[nH]c4ccccc34)n2)CC1 |
| InChI | InChI=1S/C24H34N8/c1-29-9-13-31(14-10-29)22-17-23(32-15-11-30(2)12-16-32)28-24(27-22)25-8-7-19-18-26-21-6-4-3-5-20(19)21/h3-6,17-18,26H,7-16H2,1-2H3,(H,25,27,28) |
| InChIKey | JPJVAPHGRQNQSD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |