C12H17N3O — CID 124907942
N'-[(5-methoxy-1H-indol-3-yl)methyl]ethane-1,2-diamine (PubChem CID 124907942) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is N'-[(5-methoxy-1H-indol-3-yl)methyl]ethane-1,2-diamine.
| Compound Name | N'-[(5-methoxy-1H-indol-3-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 124907942 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | N'-[(5-methoxy-1H-indol-3-yl)methyl]ethane-1,2-diamine |
| SMILES | COc1ccc2[nH]cc(CNCCN)c2c1 |
| InChI | InChI=1S/C12H17N3O/c1-16-10-2-3-12-11(6-10)9(8-15-12)7-14-5-4-13/h2-3,6,8,14-15H,4-5,7,13H2,1H3 |
| InChIKey | HWQZOPKXUWYHSD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|