C17H21Br2ClN2O3S — CID 17294144
4-[2-[(3,5-dibromo-2-ethoxyphenyl)methylamino]ethyl]benzenesulfonamide;hydrochloride (PubChem CID 17294144) has the molecular formula C17H21Br2ClN2O3S and a molecular weight of 528.69 g/mol. Its IUPAC name is 4-[2-[(3,5-dibromo-2-ethoxyphenyl)methylamino]ethyl]benzenesulfonamide;hydrochloride.
| Compound Name | 4-[2-[(3,5-dibromo-2-ethoxyphenyl)methylamino]ethyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 17294144 |
| Molecular Formula | C17H21Br2ClN2O3S |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 525.93 |
| IUPAC Name | 4-[2-[(3,5-dibromo-2-ethoxyphenyl)methylamino]ethyl]benzenesulfonamide;hydrochloride |
| SMILES | CCOc1c(Br)cc(Br)cc1CNCCc1ccc(S(N)(=O)=O)cc1.Cl |
| InChI | InChI=1S/C17H20Br2N2O3S.ClH/c1-2-24-17-13(9-14(18)10-16(17)19)11-21-8-7-12-3-5-15(6-4-12)25(20,22)23;/h3-6,9-10,21H,2,7-8,11H2,1H3,(H2,20,22,23);1H |
| InChIKey | FOIJGWUYRWMPPI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|