C15H16Br2ClNOS — CID 106042186
2-(5-chlorothiophen-2-yl)-N-[(3,5-dibromo-2-ethoxyphenyl)methyl]ethanamine (PubChem CID 106042186) has the molecular formula C15H16Br2ClNOS and a molecular weight of 453.63 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-N-[(3,5-dibromo-2-ethoxyphenyl)methyl]ethanamine.
| Compound Name | 2-(5-chlorothiophen-2-yl)-N-[(3,5-dibromo-2-ethoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 106042186 |
| Molecular Formula | C15H16Br2ClNOS |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 450.90 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-N-[(3,5-dibromo-2-ethoxyphenyl)methyl]ethanamine |
| SMILES | CCOc1c(Br)cc(Br)cc1CNCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C15H16Br2ClNOS/c1-2-20-15-10(7-11(16)8-13(15)17)9-19-6-5-12-3-4-14(18)21-12/h3-4,7-8,19H,2,5-6,9H2,1H3 |
| InChIKey | CDQUONLJGKSOAT-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|