C12H14Br2F3NO — CID 63226362
N-[(3,5-dibromo-2-ethoxyphenyl)methyl]-3,3,3-trifluoropropan-1-amine (PubChem CID 63226362) has the molecular formula C12H14Br2F3NO and a molecular weight of 405.05 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-ethoxyphenyl)methyl]-3,3,3-trifluoropropan-1-amine.
| Compound Name | N-[(3,5-dibromo-2-ethoxyphenyl)methyl]-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 63226362 |
| Molecular Formula | C12H14Br2F3NO |
| Molecular Weight | 405.05 g/mol |
| Exact Mass | 402.94 |
| IUPAC Name | N-[(3,5-dibromo-2-ethoxyphenyl)methyl]-3,3,3-trifluoropropan-1-amine |
| SMILES | CCOc1c(Br)cc(Br)cc1CNCCC(F)(F)F |
| InChI | InChI=1S/C12H14Br2F3NO/c1-2-19-11-8(5-9(13)6-10(11)14)7-18-4-3-12(15,16)17/h5-6,18H,2-4,7H2,1H3 |
| InChIKey | LKFLTHIHNWVZDM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.05 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|