C18H23ClN2O4S — CID 66532444
4-[2-[(2-chloro-5-ethoxy-4-methoxyphenyl)methylamino]ethyl]benzenesulfonamide (PubChem CID 66532444) has the molecular formula C18H23ClN2O4S and a molecular weight of 398.91 g/mol. Its IUPAC name is 4-[2-[(2-chloro-5-ethoxy-4-methoxyphenyl)methylamino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[(2-chloro-5-ethoxy-4-methoxyphenyl)methylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 66532444 |
| Molecular Formula | C18H23ClN2O4S |
| Molecular Weight | 398.91 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 4-[2-[(2-chloro-5-ethoxy-4-methoxyphenyl)methylamino]ethyl]benzenesulfonamide |
| SMILES | CCOc1cc(CNCCc2ccc(S(N)(=O)=O)cc2)c(Cl)cc1OC |
| InChI | InChI=1S/C18H23ClN2O4S/c1-3-25-18-10-14(16(19)11-17(18)24-2)12-21-9-8-13-4-6-15(7-5-13)26(20,22)23/h4-7,10-11,21H,3,8-9,12H2,1-2H3,(H2,20,22,23) |
| InChIKey | AYOAXLOIGFZCAY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.91 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|