C24H27ClN2O4S — CID 4718398
4-[2-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]ethyl]benzenesulfonamide (PubChem CID 4718398) has the molecular formula C24H27ClN2O4S and a molecular weight of 475.01 g/mol. Its IUPAC name is 4-[2-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4718398 |
| Molecular Formula | C24H27ClN2O4S |
| Molecular Weight | 475.01 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 4-[2-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]ethyl]benzenesulfonamide |
| SMILES | CCOc1cc(CNCCc2ccc(S(N)(=O)=O)cc2)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C24H27ClN2O4S/c1-2-30-24-15-19(9-12-23(24)31-17-20-5-3-4-6-22(20)25)16-27-14-13-18-7-10-21(11-8-18)32(26,28)29/h3-12,15,27H,2,13-14,16-17H2,1H3,(H2,26,28,29) |
| InChIKey | NGAKLUZJCLSSQF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.01 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|