C24H25Cl2FN2O4S — CID 66531710
4-[2-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methylamino]ethyl]benzenesulfonamide (PubChem CID 66531710) has the molecular formula C24H25Cl2FN2O4S and a molecular weight of 527.45 g/mol. Its IUPAC name is 4-[2-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methylamino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 66531710 |
| Molecular Formula | C24H25Cl2FN2O4S |
| Molecular Weight | 527.45 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | 4-[2-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methylamino]ethyl]benzenesulfonamide |
| SMILES | CCOc1cc(CNCCc2ccc(S(N)(=O)=O)cc2)c(Cl)cc1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C24H25Cl2FN2O4S/c1-2-32-23-12-17(14-29-11-10-16-6-8-18(9-7-16)34(28,30)31)21(26)13-24(23)33-15-19-20(25)4-3-5-22(19)27/h3-9,12-13,29H,2,10-11,14-15H2,1H3,(H2,28,30,31) |
| InChIKey | NCBUIROBFXXEKW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|