C24H27FN2O4S — CID 17212596
4-[2-[[3-ethoxy-2-[(2-fluorophenyl)methoxy]phenyl]methylamino]ethyl]benzenesulfonamide (PubChem CID 17212596) has the molecular formula C24H27FN2O4S and a molecular weight of 458.56 g/mol. Its IUPAC name is 4-[2-[[3-ethoxy-2-[(2-fluorophenyl)methoxy]phenyl]methylamino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[[3-ethoxy-2-[(2-fluorophenyl)methoxy]phenyl]methylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 17212596 |
| Molecular Formula | C24H27FN2O4S |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 4-[2-[[3-ethoxy-2-[(2-fluorophenyl)methoxy]phenyl]methylamino]ethyl]benzenesulfonamide |
| SMILES | CCOc1cccc(CNCCc2ccc(S(N)(=O)=O)cc2)c1OCc1ccccc1F |
| InChI | InChI=1S/C24H27FN2O4S/c1-2-30-23-9-5-7-19(24(23)31-17-20-6-3-4-8-22(20)25)16-27-15-14-18-10-12-21(13-11-18)32(26,28)29/h3-13,27H,2,14-17H2,1H3,(H2,26,28,29) |
| InChIKey | VSEDKLHPBUMFQJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|