C24H26Cl3NO2 — CID 17208783
2-(4-chlorophenyl)-N-[[2-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]ethanamine;hydrochloride (PubChem CID 17208783) has the molecular formula C24H26Cl3NO2 and a molecular weight of 466.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[[2-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]ethanamine;hydrochloride.
| Compound Name | 2-(4-chlorophenyl)-N-[[2-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17208783 |
| Molecular Formula | C24H26Cl3NO2 |
| Molecular Weight | 466.84 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[[2-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]ethanamine;hydrochloride |
| SMILES | CCOc1cccc(CNCCc2ccc(Cl)cc2)c1OCc1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C24H25Cl2NO2.ClH/c1-2-28-23-5-3-4-20(16-27-15-14-18-6-10-21(25)11-7-18)24(23)29-17-19-8-12-22(26)13-9-19;/h3-13,27H,2,14-17H2,1H3;1H |
| InChIKey | BTNIAKURYQPYJH-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.84 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|