C21H29Cl2NO2 — CID 17291067
N-[[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]hexan-1-amine;hydrochloride (PubChem CID 17291067) has the molecular formula C21H29Cl2NO2 and a molecular weight of 398.37 g/mol. Its IUPAC name is N-[[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]hexan-1-amine;hydrochloride.
| Compound Name | N-[[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]hexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17291067 |
| Molecular Formula | C21H29Cl2NO2 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-[[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]hexan-1-amine;hydrochloride |
| SMILES | CCCCCCNCc1cccc(OC)c1OCc1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C21H28ClNO2.ClH/c1-3-4-5-6-14-23-15-18-8-7-9-20(24-2)21(18)25-16-17-10-12-19(22)13-11-17;/h7-13,23H,3-6,14-16H2,1-2H3;1H |
| InChIKey | MIJKAUFIQVRSQW-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|