C22H31ClFNO3 — CID 17207628
3-butoxy-N-[[2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]propan-1-amine;hydrochloride (PubChem CID 17207628) has the molecular formula C22H31ClFNO3 and a molecular weight of 411.95 g/mol. Its IUPAC name is 3-butoxy-N-[[2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]propan-1-amine;hydrochloride.
| Compound Name | 3-butoxy-N-[[2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17207628 |
| Molecular Formula | C22H31ClFNO3 |
| Molecular Weight | 411.95 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 3-butoxy-N-[[2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]propan-1-amine;hydrochloride |
| SMILES | CCCCOCCCNCc1cccc(OC)c1OCc1ccc(F)cc1.Cl |
| InChI | InChI=1S/C22H30FNO3.ClH/c1-3-4-14-26-15-6-13-24-16-19-7-5-8-21(25-2)22(19)27-17-18-9-11-20(23)12-10-18;/h5,7-12,24H,3-4,6,13-17H2,1-2H3;1H |
| InChIKey | PXPOVXPJWVJXLO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.95 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|