C22H31FN2O2 — CID 17214994
N',N'-diethyl-N-[[2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]propane-1,3-diamine (PubChem CID 17214994) has the molecular formula C22H31FN2O2 and a molecular weight of 374.50 g/mol. Its IUPAC name is N',N'-diethyl-N-[[2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-[[2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 17214994 |
| Molecular Formula | C22H31FN2O2 |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | N',N'-diethyl-N-[[2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]propane-1,3-diamine |
| SMILES | CCN(CC)CCCNCc1cccc(OC)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H31FN2O2/c1-4-25(5-2)15-7-14-24-16-19-8-6-9-21(26-3)22(19)27-17-18-10-12-20(23)13-11-18/h6,8-13,24H,4-5,7,14-17H2,1-3H3 |
| InChIKey | PLCXTEZAYMKKBG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|