C25H33Cl2FN2O — CID 17215108
N',N'-diethyl-N-[[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methyl]propane-1,3-diamine;dihydrochloride (PubChem CID 17215108) has the molecular formula C25H33Cl2FN2O and a molecular weight of 467.46 g/mol. Its IUPAC name is N',N'-diethyl-N-[[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methyl]propane-1,3-diamine;dihydrochloride.
| Compound Name | N',N'-diethyl-N-[[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methyl]propane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17215108 |
| Molecular Formula | C25H33Cl2FN2O |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | N',N'-diethyl-N-[[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methyl]propane-1,3-diamine;dihydrochloride |
| SMILES | CCN(CC)CCCNCc1c(OCc2ccc(F)cc2)ccc2ccccc12.Cl.Cl |
| InChI | InChI=1S/C25H31FN2O.2ClH/c1-3-28(4-2)17-7-16-27-18-24-23-9-6-5-8-21(23)12-15-25(24)29-19-20-10-13-22(26)14-11-20;;/h5-6,8-15,27H,3-4,7,16-19H2,1-2H3;2*1H |
| InChIKey | QLOLQZUYEFITKL-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|