C22H28Cl2N2O — CID 17294780
N',N'-dimethyl-N-[(2-phenylmethoxynaphthalen-1-yl)methyl]ethane-1,2-diamine;dihydrochloride (PubChem CID 17294780) has the molecular formula C22H28Cl2N2O and a molecular weight of 407.39 g/mol. Its IUPAC name is N',N'-dimethyl-N-[(2-phenylmethoxynaphthalen-1-yl)methyl]ethane-1,2-diamine;dihydrochloride.
| Compound Name | N',N'-dimethyl-N-[(2-phenylmethoxynaphthalen-1-yl)methyl]ethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17294780 |
| Molecular Formula | C22H28Cl2N2O |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | N',N'-dimethyl-N-[(2-phenylmethoxynaphthalen-1-yl)methyl]ethane-1,2-diamine;dihydrochloride |
| SMILES | CN(C)CCNCc1c(OCc2ccccc2)ccc2ccccc12.Cl.Cl |
| InChI | InChI=1S/C22H26N2O.2ClH/c1-24(2)15-14-23-16-21-20-11-7-6-10-19(20)12-13-22(21)25-17-18-8-4-3-5-9-18;;/h3-13,23H,14-17H2,1-2H3;2*1H |
| InChIKey | QDEWNLLMAKBWKA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|