C22H26ClNO — CID 17291277
2-methyl-N-[(2-phenylmethoxynaphthalen-1-yl)methyl]propan-1-amine;hydrochloride (PubChem CID 17291277) has the molecular formula C22H26ClNO and a molecular weight of 355.91 g/mol. Its IUPAC name is 2-methyl-N-[(2-phenylmethoxynaphthalen-1-yl)methyl]propan-1-amine;hydrochloride.
| Compound Name | 2-methyl-N-[(2-phenylmethoxynaphthalen-1-yl)methyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17291277 |
| Molecular Formula | C22H26ClNO |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 2-methyl-N-[(2-phenylmethoxynaphthalen-1-yl)methyl]propan-1-amine;hydrochloride |
| SMILES | CC(C)CNCc1c(OCc2ccccc2)ccc2ccccc12.Cl |
| InChI | InChI=1S/C22H25NO.ClH/c1-17(2)14-23-15-21-20-11-7-6-10-19(20)12-13-22(21)24-16-18-8-4-3-5-9-18;/h3-13,17,23H,14-16H2,1-2H3;1H |
| InChIKey | WUNLRLHCIDDMQL-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |