C21H24ClNO — CID 17155735
N-[(2-phenylmethoxynaphthalen-1-yl)methyl]propan-2-amine;hydrochloride (PubChem CID 17155735) has the molecular formula C21H24ClNO and a molecular weight of 341.88 g/mol. Its IUPAC name is N-[(2-phenylmethoxynaphthalen-1-yl)methyl]propan-2-amine;hydrochloride.
| Compound Name | N-[(2-phenylmethoxynaphthalen-1-yl)methyl]propan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 17155735 |
| Molecular Formula | C21H24ClNO |
| Molecular Weight | 341.88 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | N-[(2-phenylmethoxynaphthalen-1-yl)methyl]propan-2-amine;hydrochloride |
| SMILES | CC(C)NCc1c(OCc2ccccc2)ccc2ccccc12.Cl |
| InChI | InChI=1S/C21H23NO.ClH/c1-16(2)22-14-20-19-11-7-6-10-18(19)12-13-21(20)23-15-17-8-4-3-5-9-17;/h3-13,16,22H,14-15H2,1-2H3;1H |
| InChIKey | CITLPGOAUVMRHR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.88 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |