C23H25ClN2O3 — CID 66526459
N-[[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-pyridin-2-yloxypropan-1-amine (PubChem CID 66526459) has the molecular formula C23H25ClN2O3 and a molecular weight of 412.92 g/mol. Its IUPAC name is N-[[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-pyridin-2-yloxypropan-1-amine.
| Compound Name | N-[[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-pyridin-2-yloxypropan-1-amine |
|---|---|
| PubChem CID | 66526459 |
| Molecular Formula | C23H25ClN2O3 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-[[2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-pyridin-2-yloxypropan-1-amine |
| SMILES | COc1cccc(CNCCCOc2ccccn2)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H25ClN2O3/c1-27-21-7-4-6-19(23(21)29-17-18-9-11-20(24)12-10-18)16-25-13-5-15-28-22-8-2-3-14-26-22/h2-4,6-12,14,25H,5,13,15-17H2,1H3 |
| InChIKey | MMZJXMKIFLXRSK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|