C21H31Cl2FN2O3 — CID 17216203
1-[2-[[3-ethoxy-2-[(2-fluorophenyl)methoxy]phenyl]methylamino]ethylamino]propan-2-ol;dihydrochloride (PubChem CID 17216203) has the molecular formula C21H31Cl2FN2O3 and a molecular weight of 449.39 g/mol. Its IUPAC name is 1-[2-[[3-ethoxy-2-[(2-fluorophenyl)methoxy]phenyl]methylamino]ethylamino]propan-2-ol;dihydrochloride.
| Compound Name | 1-[2-[[3-ethoxy-2-[(2-fluorophenyl)methoxy]phenyl]methylamino]ethylamino]propan-2-ol;dihydrochloride |
|---|---|
| PubChem CID | 17216203 |
| Molecular Formula | C21H31Cl2FN2O3 |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 1-[2-[[3-ethoxy-2-[(2-fluorophenyl)methoxy]phenyl]methylamino]ethylamino]propan-2-ol;dihydrochloride |
| SMILES | CCOc1cccc(CNCCNCC(C)O)c1OCc1ccccc1F.Cl.Cl |
| InChI | InChI=1S/C21H29FN2O3.2ClH/c1-3-26-20-10-6-8-17(14-24-12-11-23-13-16(2)25)21(20)27-15-18-7-4-5-9-19(18)22;;/h4-10,16,23-25H,3,11-15H2,1-2H3;2*1H |
| InChIKey | ORHCMHWUHIJDGJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|