C24H27Cl3N2O4S — CID 17292800
4-[2-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]ethyl]benzenesulfonamide;hydrochloride (PubChem CID 17292800) has the molecular formula C24H27Cl3N2O4S and a molecular weight of 545.92 g/mol. Its IUPAC name is 4-[2-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]ethyl]benzenesulfonamide;hydrochloride.
| Compound Name | 4-[2-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]ethyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 17292800 |
| Molecular Formula | C24H27Cl3N2O4S |
| Molecular Weight | 545.92 g/mol |
| Exact Mass | 544.08 |
| IUPAC Name | 4-[2-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]ethyl]benzenesulfonamide;hydrochloride |
| SMILES | CCOc1cc(CNCCc2ccc(S(N)(=O)=O)cc2)ccc1OCc1ccc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C24H26Cl2N2O4S.ClH/c1-2-31-24-13-18(5-10-23(24)32-16-19-6-7-20(25)14-22(19)26)15-28-12-11-17-3-8-21(9-4-17)33(27,29)30;/h3-10,13-14,28H,2,11-12,15-16H2,1H3,(H2,27,29,30);1H |
| InChIKey | GXNNXKHQFVASQX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.92 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|