C23H34Cl4N2O2 — CID 17215005
N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-N',N'-diethylpropane-1,3-diamine;dihydrochloride (PubChem CID 17215005) has the molecular formula C23H34Cl4N2O2 and a molecular weight of 512.35 g/mol. Its IUPAC name is N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-N',N'-diethylpropane-1,3-diamine;dihydrochloride.
| Compound Name | N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-N',N'-diethylpropane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17215005 |
| Molecular Formula | C23H34Cl4N2O2 |
| Molecular Weight | 512.35 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-N',N'-diethylpropane-1,3-diamine;dihydrochloride |
| SMILES | CCOc1cc(CNCCCN(CC)CC)ccc1OCc1ccc(Cl)cc1Cl.Cl.Cl |
| InChI | InChI=1S/C23H32Cl2N2O2.2ClH/c1-4-27(5-2)13-7-12-26-16-18-8-11-22(23(14-18)28-6-3)29-17-19-9-10-20(24)15-21(19)25;;/h8-11,14-15,26H,4-7,12-13,16-17H2,1-3H3;2*1H |
| InChIKey | NJCLEZACABTJLL-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.35 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|