C24H25Cl4NO2 — CID 17208457
2-(4-chlorophenyl)-N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methyl]ethanamine;hydrochloride (PubChem CID 17208457) has the molecular formula C24H25Cl4NO2 and a molecular weight of 501.28 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methyl]ethanamine;hydrochloride.
| Compound Name | 2-(4-chlorophenyl)-N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17208457 |
| Molecular Formula | C24H25Cl4NO2 |
| Molecular Weight | 501.28 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methyl]ethanamine;hydrochloride |
| SMILES | CCOc1cc(CNCCc2ccc(Cl)cc2)ccc1OCc1ccc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C24H24Cl3NO2.ClH/c1-2-29-24-13-18(15-28-12-11-17-3-7-20(25)8-4-17)5-10-23(24)30-16-19-6-9-21(26)14-22(19)27;/h3-10,13-14,28H,2,11-12,15-16H2,1H3;1H |
| InChIKey | PXCXANCFEAVEMO-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.28 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|