C23H31Cl2NO2 — CID 4716899
N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methyl]heptan-1-amine (PubChem CID 4716899) has the molecular formula C23H31Cl2NO2 and a molecular weight of 424.41 g/mol. Its IUPAC name is N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methyl]heptan-1-amine.
| Compound Name | N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methyl]heptan-1-amine |
|---|---|
| PubChem CID | 4716899 |
| Molecular Formula | C23H31Cl2NO2 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methyl]heptan-1-amine |
| SMILES | CCCCCCCNCc1ccc(OCc2ccc(Cl)cc2Cl)c(OCC)c1 |
| InChI | InChI=1S/C23H31Cl2NO2/c1-3-5-6-7-8-13-26-16-18-9-12-22(23(14-18)27-4-2)28-17-19-10-11-20(24)15-21(19)25/h9-12,14-15,26H,3-8,13,16-17H2,1-2H3 |
| InChIKey | IWPXIOPSSXRGGY-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|