C20H25Cl2NO3 — CID 4716372
N-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-ethoxypropan-1-amine (PubChem CID 4716372) has the molecular formula C20H25Cl2NO3 and a molecular weight of 398.33 g/mol. Its IUPAC name is N-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-ethoxypropan-1-amine.
| Compound Name | N-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-ethoxypropan-1-amine |
|---|---|
| PubChem CID | 4716372 |
| Molecular Formula | C20H25Cl2NO3 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | N-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-ethoxypropan-1-amine |
| SMILES | CCOCCCNCc1ccc(OCc2ccc(Cl)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C20H25Cl2NO3/c1-3-25-10-4-9-23-13-15-5-8-19(20(11-15)24-2)26-14-16-6-7-17(21)12-18(16)22/h5-8,11-12,23H,3-4,9-10,13-14H2,1-2H3 |
| InChIKey | KGMQOPUNLKXALI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|