C23H30Cl2FNO2 — CID 66531690
N-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]heptan-1-amine (PubChem CID 66531690) has the molecular formula C23H30Cl2FNO2 and a molecular weight of 442.40 g/mol. Its IUPAC name is N-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]heptan-1-amine.
| Compound Name | N-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]heptan-1-amine |
|---|---|
| PubChem CID | 66531690 |
| Molecular Formula | C23H30Cl2FNO2 |
| Molecular Weight | 442.40 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | N-[[2-chloro-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]heptan-1-amine |
| SMILES | CCCCCCCNCc1cc(OCC)c(OCc2c(F)cccc2Cl)cc1Cl |
| InChI | InChI=1S/C23H30Cl2FNO2/c1-3-5-6-7-8-12-27-15-17-13-22(28-4-2)23(14-20(17)25)29-16-18-19(24)10-9-11-21(18)26/h9-11,13-14,27H,3-8,12,15-16H2,1-2H3 |
| InChIKey | RKKKOCKBDXNFNE-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.40 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|