C20H24Cl3NO3 — CID 66531776
N-[[2-chloro-4-[(2,6-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-methoxypropan-1-amine (PubChem CID 66531776) has the molecular formula C20H24Cl3NO3 and a molecular weight of 432.78 g/mol. Its IUPAC name is N-[[2-chloro-4-[(2,6-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-methoxypropan-1-amine.
| Compound Name | N-[[2-chloro-4-[(2,6-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-methoxypropan-1-amine |
|---|---|
| PubChem CID | 66531776 |
| Molecular Formula | C20H24Cl3NO3 |
| Molecular Weight | 432.78 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | N-[[2-chloro-4-[(2,6-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-methoxypropan-1-amine |
| SMILES | CCOc1cc(CNCCCOC)c(Cl)cc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C20H24Cl3NO3/c1-3-26-19-10-14(12-24-8-5-9-25-2)18(23)11-20(19)27-13-15-16(21)6-4-7-17(15)22/h4,6-7,10-11,24H,3,5,8-9,12-13H2,1-2H3 |
| InChIKey | LXOIQOJARAAOQN-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.78 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|